C30H39NO5S — CID 122229704
1-[(2S,4Z,6S,7S)-7-acetyl-7-hydroxy-1-(4-methylphenyl)sulfonyl-2-(2-phenylethyl)-2,3,6,8-tetrahydroazocin-6-yl]-3,3-dimethylbutan-2-one (PubChem CID 122229704) has the molecular formula C30H39NO5S and a molecular weight of 525.71 g/mol. Its IUPAC name is 1-[(2S,4Z,6S,7S)-7-acetyl-7-hydroxy-1-(4-methylphenyl)sulfonyl-2-(2-phenylethyl)-2,3,6,8-tetrahydroazocin-6-yl]-3,3-dimethylbutan-2-one.
| Compound Name | 1-[(2S,4Z,6S,7S)-7-acetyl-7-hydroxy-1-(4-methylphenyl)sulfonyl-2-(2-phenylethyl)-2,3,6,8-tetrahydroazocin-6-yl]-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 122229704 |
| Molecular Formula | C30H39NO5S |
| Molecular Weight | 525.71 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | 1-[(2S,4Z,6S,7S)-7-acetyl-7-hydroxy-1-(4-methylphenyl)sulfonyl-2-(2-phenylethyl)-2,3,6,8-tetrahydroazocin-6-yl]-3,3-dimethylbutan-2-one |
| SMILES | CC(=O)[C@@]1(O)CN(S(=O)(=O)c2ccc(C)cc2)[C@@H](CCc2ccccc2)C/C=C\[C@@H]1CC(=O)C(C)(C)C |
| InChI | InChI=1S/C30H39NO5S/c1-22-14-18-27(19-15-22)37(35,36)31-21-30(34,23(2)32)25(20-28(33)29(3,4)5)12-9-13-26(31)17-16-24-10-7-6-8-11-24/h6-12,14-15,18-19,25-26,34H,13,16-17,20-21H2,1-5H3/b12-9-/t25-,26-,30+/m1/s1 |
| InChIKey | OTBZNRCMLJCSCR-XPFXMXSLSA-N |
| XLogP | 4.89 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.71 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|