C31H47NO6SSi — CID 122231158
N-[[(2R,3S,7R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylmethoxy-7-propan-2-yloxy-2,3,6,7-tetrahydrooxepin-4-yl]methyl]-4-methylbenzenesulfonamide (PubChem CID 122231158) has the molecular formula C31H47NO6SSi and a molecular weight of 589.87 g/mol. Its IUPAC name is N-[[(2R,3S,7R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylmethoxy-7-propan-2-yloxy-2,3,6,7-tetrahydrooxepin-4-yl]methyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[[(2R,3S,7R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylmethoxy-7-propan-2-yloxy-2,3,6,7-tetrahydrooxepin-4-yl]methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 122231158 |
| Molecular Formula | C31H47NO6SSi |
| Molecular Weight | 589.87 g/mol |
| Exact Mass | 589.29 |
| IUPAC Name | N-[[(2R,3S,7R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylmethoxy-7-propan-2-yloxy-2,3,6,7-tetrahydrooxepin-4-yl]methyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC2=CC[C@H](OC(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C31H47NO6SSi/c1-23(2)37-29-19-16-26(20-32-39(33,34)27-17-14-24(3)15-18-27)30(35-21-25-12-10-9-11-13-25)28(38-29)22-36-40(7,8)31(4,5)6/h9-18,23,28-30,32H,19-22H2,1-8H3/t28-,29-,30+/m1/s1 |
| InChIKey | YBAXNUNYSKGAHE-OCBJUFRSSA-N |
| XLogP | 6.35 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.87 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|