C49H50N2OP2 — CID 122363787
2,5-bis[2,6-bis(2,4,6-trimethylphenyl)phenyl]-2,5-diaza-1,4-diphosphabicyclo[2.1.0]pentan-3-one (PubChem CID 122363787) has the molecular formula C49H50N2OP2 and a molecular weight of 744.90 g/mol. Its IUPAC name is 2,5-bis[2,6-bis(2,4,6-trimethylphenyl)phenyl]-2,5-diaza-1,4-diphosphabicyclo[2.1.0]pentan-3-one.
| Compound Name | 2,5-bis[2,6-bis(2,4,6-trimethylphenyl)phenyl]-2,5-diaza-1,4-diphosphabicyclo[2.1.0]pentan-3-one |
|---|---|
| PubChem CID | 122363787 |
| Molecular Formula | C49H50N2OP2 |
| Molecular Weight | 744.90 g/mol |
| Exact Mass | 744.34 |
| IUPAC Name | 2,5-bis[2,6-bis(2,4,6-trimethylphenyl)phenyl]-2,5-diaza-1,4-diphosphabicyclo[2.1.0]pentan-3-one |
| SMILES | Cc1cc(C)c(-c2cccc(-c3c(C)cc(C)cc3C)c2-n2c(=O)p3n(-c4c(-c5c(C)cc(C)cc5C)cccc4-c4c(C)cc(C)cc4C)p23)c(C)c1 |
| InChI | InChI=1S/C49H50N2OP2/c1-27-19-31(5)43(32(6)20-27)39-15-13-16-40(44-33(7)21-28(2)22-34(44)8)47(39)50-49(52)53-51(54(50)53)48-41(45-35(9)23-29(3)24-36(45)10)17-14-18-42(48)46-37(11)25-30(4)26-38(46)12/h13-26H,1-12H3 |
| InChIKey | WTLVVDJIAUAIRX-UHFFFAOYSA-N |
| XLogP | 14.16 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.90 |
| LogP ≤ 5 | 14.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |