C20H17NO2 — CID 122363894
(1S,10aR)-2-nitro-1-phenyl-1,9,10,10a-tetrahydrophenanthrene (PubChem CID 122363894) has the molecular formula C20H17NO2 and a molecular weight of 303.36 g/mol. Its IUPAC name is (1S,10aR)-2-nitro-1-phenyl-1,9,10,10a-tetrahydrophenanthrene.
| Compound Name | (1S,10aR)-2-nitro-1-phenyl-1,9,10,10a-tetrahydrophenanthrene |
|---|---|
| PubChem CID | 122363894 |
| Molecular Formula | C20H17NO2 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | (1S,10aR)-2-nitro-1-phenyl-1,9,10,10a-tetrahydrophenanthrene |
| SMILES | O=[N+]([O-])C1=CC=C2c3ccccc3CC[C@@H]2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H17NO2/c22-21(23)19-13-12-17-16-9-5-4-6-14(16)10-11-18(17)20(19)15-7-2-1-3-8-15/h1-9,12-13,18,20H,10-11H2/t18-,20+/m0/s1 |
| InChIKey | VUPSAZSFLLEWRY-AZUAARDMSA-N |
| XLogP | 4.59 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|