C26H33N2O7P — CID 122364814
6,12-dimethyl-4,14-bis(morpholin-4-ylmethyl)-9-oxido-8,10-dioxa-9-phosphoniatetracyclo[7.7.1.02,7.011,16]heptadeca-2(7),3,5,11(16),12,14-hexaene-5,13-diol (PubChem CID 122364814) has the molecular formula C26H33N2O7P and a molecular weight of 516.53 g/mol. Its IUPAC name is 6,12-dimethyl-4,14-bis(morpholin-4-ylmethyl)-9-oxido-8,10-dioxa-9-phosphoniatetracyclo[7.7.1.02,7.011,16]heptadeca-2(7),3,5,11(16),12,14-hexaene-5,13-diol.
| Compound Name | 6,12-dimethyl-4,14-bis(morpholin-4-ylmethyl)-9-oxido-8,10-dioxa-9-phosphoniatetracyclo[7.7.1.02,7.011,16]heptadeca-2(7),3,5,11(16),12,14-hexaene-5,13-diol |
|---|---|
| PubChem CID | 122364814 |
| Molecular Formula | C26H33N2O7P |
| Molecular Weight | 516.53 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | 6,12-dimethyl-4,14-bis(morpholin-4-ylmethyl)-9-oxido-8,10-dioxa-9-phosphoniatetracyclo[7.7.1.02,7.011,16]heptadeca-2(7),3,5,11(16),12,14-hexaene-5,13-diol |
| SMILES | Cc1c(O)c(CN2CCOCC2)cc2c1O[P+]1([O-])CC2c2cc(CN3CCOCC3)c(O)c(C)c2O1 |
| InChI | InChI=1S/C26H33N2O7P/c1-16-23(29)18(13-27-3-7-32-8-4-27)11-20-22-15-36(31,34-25(16)20)35-26-17(2)24(30)19(12-21(22)26)14-28-5-9-33-10-6-28/h11-12,22,29-30H,3-10,13-15H2,1-2H3 |
| InChIKey | SEFUIQPNBUXKMD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.53 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|