C27H42N2O6 — CID 122379374
ethyl 2-ethenyl-1-[[6-[(2-ethenyl-1-ethoxycarbonylcyclopropanecarbonyl)amino]-3,3,5-trimethylhexyl]carbamoyl]cyclopropane-1-carboxylate (PubChem CID 122379374) has the molecular formula C27H42N2O6 and a molecular weight of 490.64 g/mol. Its IUPAC name is ethyl 2-ethenyl-1-[[6-[(2-ethenyl-1-ethoxycarbonylcyclopropanecarbonyl)amino]-3,3,5-trimethylhexyl]carbamoyl]cyclopropane-1-carboxylate.
| Compound Name | ethyl 2-ethenyl-1-[[6-[(2-ethenyl-1-ethoxycarbonylcyclopropanecarbonyl)amino]-3,3,5-trimethylhexyl]carbamoyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 122379374 |
| Molecular Formula | C27H42N2O6 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.30 |
| IUPAC Name | ethyl 2-ethenyl-1-[[6-[(2-ethenyl-1-ethoxycarbonylcyclopropanecarbonyl)amino]-3,3,5-trimethylhexyl]carbamoyl]cyclopropane-1-carboxylate |
| SMILES | C=CC1CC1(C(=O)NCCC(C)(C)CC(C)CNC(=O)C1(C(=O)OCC)CC1C=C)C(=O)OCC |
| InChI | InChI=1S/C27H42N2O6/c1-8-19-15-26(19,23(32)34-10-3)21(30)28-13-12-25(6,7)14-18(5)17-29-22(31)27(16-20(27)9-2)24(33)35-11-4/h8-9,18-20H,1-2,10-17H2,3-7H3,(H,28,30)(H,29,31) |
| InChIKey | HKUJGUBLJKVWIR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|