C21H23NO3S — CID 122389712
(2'S,3R)-2'-methyl-1'-(4-methylphenyl)sulfonylspiro[1H-2-benzofuran-3,3'-4,7-dihydro-2H-azepine] (PubChem CID 122389712) has the molecular formula C21H23NO3S and a molecular weight of 369.49 g/mol. Its IUPAC name is (2'S,3R)-2'-methyl-1'-(4-methylphenyl)sulfonylspiro[1H-2-benzofuran-3,3'-4,7-dihydro-2H-azepine].
| Compound Name | (2'S,3R)-2'-methyl-1'-(4-methylphenyl)sulfonylspiro[1H-2-benzofuran-3,3'-4,7-dihydro-2H-azepine] |
|---|---|
| PubChem CID | 122389712 |
| Molecular Formula | C21H23NO3S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | (2'S,3R)-2'-methyl-1'-(4-methylphenyl)sulfonylspiro[1H-2-benzofuran-3,3'-4,7-dihydro-2H-azepine] |
| SMILES | Cc1ccc(S(=O)(=O)N2CC=CC[C@]3(OCc4ccccc43)[C@@H]2C)cc1 |
| InChI | InChI=1S/C21H23NO3S/c1-16-9-11-19(12-10-16)26(23,24)22-14-6-5-13-21(17(22)2)20-8-4-3-7-18(20)15-25-21/h3-12,17H,13-15H2,1-2H3/t17-,21-/m0/s1 |
| InChIKey | HYTSQDWALJIBFH-UWJYYQICSA-N |
| XLogP | 3.76 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|