C21H21F5O3S — CID 122500758
2-[4-[(3,4-difluorophenoxy)-difluoromethyl]-3-fluorophenyl]-5-(2-ethoxyethyl)-1,3-oxathiane (PubChem CID 122500758) has the molecular formula C21H21F5O3S and a molecular weight of 448.45 g/mol. Its IUPAC name is 2-[4-[(3,4-difluorophenoxy)-difluoromethyl]-3-fluorophenyl]-5-(2-ethoxyethyl)-1,3-oxathiane.
| Compound Name | 2-[4-[(3,4-difluorophenoxy)-difluoromethyl]-3-fluorophenyl]-5-(2-ethoxyethyl)-1,3-oxathiane |
|---|---|
| PubChem CID | 122500758 |
| Molecular Formula | C21H21F5O3S |
| Molecular Weight | 448.45 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 2-[4-[(3,4-difluorophenoxy)-difluoromethyl]-3-fluorophenyl]-5-(2-ethoxyethyl)-1,3-oxathiane |
| SMILES | CCOCCC1COC(c2ccc(C(F)(F)Oc3ccc(F)c(F)c3)c(F)c2)SC1 |
| InChI | InChI=1S/C21H21F5O3S/c1-2-27-8-7-13-11-28-20(30-12-13)14-3-5-16(18(23)9-14)21(25,26)29-15-4-6-17(22)19(24)10-15/h3-6,9-10,13,20H,2,7-8,11-12H2,1H3 |
| InChIKey | QJUIPENGXTVUKJ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.45 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|