C31H32O7 — CID 122514744
2-[(2R)-2-(2-carboxyphenyl)propyl]-3-[(2R,3R,4S,5S)-4-hydroxy-3-phenylmethoxy-5-prop-2-enyloxolan-2-yl]benzoic acid (PubChem CID 122514744) has the molecular formula C31H32O7 and a molecular weight of 516.59 g/mol. Its IUPAC name is 2-[(2R)-2-(2-carboxyphenyl)propyl]-3-[(2R,3R,4S,5S)-4-hydroxy-3-phenylmethoxy-5-prop-2-enyloxolan-2-yl]benzoic acid.
| Compound Name | 2-[(2R)-2-(2-carboxyphenyl)propyl]-3-[(2R,3R,4S,5S)-4-hydroxy-3-phenylmethoxy-5-prop-2-enyloxolan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 122514744 |
| Molecular Formula | C31H32O7 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | 2-[(2R)-2-(2-carboxyphenyl)propyl]-3-[(2R,3R,4S,5S)-4-hydroxy-3-phenylmethoxy-5-prop-2-enyloxolan-2-yl]benzoic acid |
| SMILES | C=CC[C@@H]1O[C@H](c2cccc(C(=O)O)c2C[C@@H](C)c2ccccc2C(=O)O)[C@H](OCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C31H32O7/c1-3-10-26-27(32)29(37-18-20-11-5-4-6-12-20)28(38-26)22-15-9-16-24(31(35)36)25(22)17-19(2)21-13-7-8-14-23(21)30(33)34/h3-9,11-16,19,26-29,32H,1,10,17-18H2,2H3,(H,33,34)(H,35,36)/t19-,26+,27+,28-,29-/m1/s1 |
| InChIKey | CXXBGIDQVJEJFX-LPZLZAQYSA-N |
| XLogP | 5.39 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|