C12H18N2O3 — CID 122522322
1-[[(3aR,4R,6S,6aS)-2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]methyl]pyrazole (PubChem CID 122522322) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is 1-[[(3aR,4R,6S,6aS)-2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]methyl]pyrazole.
| Compound Name | 1-[[(3aR,4R,6S,6aS)-2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]methyl]pyrazole |
|---|---|
| PubChem CID | 122522322 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 1-[[(3aR,4R,6S,6aS)-2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]methyl]pyrazole |
| SMILES | C[C@@H]1O[C@H](Cn2cccn2)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C12H18N2O3/c1-8-10-11(17-12(2,3)16-10)9(15-8)7-14-6-4-5-13-14/h4-6,8-11H,7H2,1-3H3/t8-,9+,10-,11+/m0/s1 |
| InChIKey | ZNSQRQUKXSMZII-ZRUFSTJUSA-N |
| XLogP | 1.19 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |