C19H32O6 — CID 122544028
2,2,4,6,6-pentamethyl-4-[(5-methyl-2-oxo-1,3-dioxan-5-yl)methoxymethyl]heptane-3,5-dione (PubChem CID 122544028) has the molecular formula C19H32O6 and a molecular weight of 356.46 g/mol. Its IUPAC name is 2,2,4,6,6-pentamethyl-4-[(5-methyl-2-oxo-1,3-dioxan-5-yl)methoxymethyl]heptane-3,5-dione.
| Compound Name | 2,2,4,6,6-pentamethyl-4-[(5-methyl-2-oxo-1,3-dioxan-5-yl)methoxymethyl]heptane-3,5-dione |
|---|---|
| PubChem CID | 122544028 |
| Molecular Formula | C19H32O6 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 2,2,4,6,6-pentamethyl-4-[(5-methyl-2-oxo-1,3-dioxan-5-yl)methoxymethyl]heptane-3,5-dione |
| SMILES | CC1(COCC(C)(C(=O)C(C)(C)C)C(=O)C(C)(C)C)COC(=O)OC1 |
| InChI | InChI=1S/C19H32O6/c1-16(2,3)13(20)19(8,14(21)17(4,5)6)12-23-9-18(7)10-24-15(22)25-11-18/h9-12H2,1-8H3 |
| InChIKey | WLSPPNRYTSFFHJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|