C34H36FN3O6 — CID 122577389
benzyl N-[(Z,3S,6R)-9-(1,3-dioxoisoindol-2-yl)-4-fluoro-6-[[4-(hydroxymethyl)phenyl]carbamoyl]-2-methylnon-4-en-3-yl]carbamate (PubChem CID 122577389) has the molecular formula C34H36FN3O6 and a molecular weight of 601.68 g/mol. Its IUPAC name is benzyl N-[(Z,3S,6R)-9-(1,3-dioxoisoindol-2-yl)-4-fluoro-6-[[4-(hydroxymethyl)phenyl]carbamoyl]-2-methylnon-4-en-3-yl]carbamate.
| Compound Name | benzyl N-[(Z,3S,6R)-9-(1,3-dioxoisoindol-2-yl)-4-fluoro-6-[[4-(hydroxymethyl)phenyl]carbamoyl]-2-methylnon-4-en-3-yl]carbamate |
|---|---|
| PubChem CID | 122577389 |
| Molecular Formula | C34H36FN3O6 |
| Molecular Weight | 601.68 g/mol |
| Exact Mass | 601.26 |
| IUPAC Name | benzyl N-[(Z,3S,6R)-9-(1,3-dioxoisoindol-2-yl)-4-fluoro-6-[[4-(hydroxymethyl)phenyl]carbamoyl]-2-methylnon-4-en-3-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)/C(F)=C/[C@@H](CCCN1C(=O)c2ccccc2C1=O)C(=O)Nc1ccc(CO)cc1 |
| InChI | InChI=1S/C34H36FN3O6/c1-22(2)30(37-34(43)44-21-24-9-4-3-5-10-24)29(35)19-25(31(40)36-26-16-14-23(20-39)15-17-26)11-8-18-38-32(41)27-12-6-7-13-28(27)33(38)42/h3-7,9-10,12-17,19,22,25,30,39H,8,11,18,20-21H2,1-2H3,(H,36,40)(H,37,43)/b29-19-/t25-,30+/m1/s1 |
| InChIKey | HKEDMINSAHWMIH-FXIBFRGRSA-N |
| XLogP | 5.61 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.68 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|