C26H35F3N6O2 — CID 122585102
8-[(2,4-dimethoxyphenyl)methyl]-4-N-[(2R)-2-methyl-1-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]hexan-2-yl]pyrido[3,2-d]pyrimidine-2,4-diamine (PubChem CID 122585102) has the molecular formula C26H35F3N6O2 and a molecular weight of 520.60 g/mol. Its IUPAC name is 8-[(2,4-dimethoxyphenyl)methyl]-4-N-[(2R)-2-methyl-1-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]hexan-2-yl]pyrido[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 8-[(2,4-dimethoxyphenyl)methyl]-4-N-[(2R)-2-methyl-1-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]hexan-2-yl]pyrido[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 122585102 |
| Molecular Formula | C26H35F3N6O2 |
| Molecular Weight | 520.60 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | 8-[(2,4-dimethoxyphenyl)methyl]-4-N-[(2R)-2-methyl-1-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]hexan-2-yl]pyrido[3,2-d]pyrimidine-2,4-diamine |
| SMILES | CCCC[C@](C)(CN[C@@H](C)C(F)(F)F)Nc1nc(N)nc2c(Cc3ccc(OC)cc3OC)ccnc12 |
| InChI | InChI=1S/C26H35F3N6O2/c1-6-7-11-25(3,15-32-16(2)26(27,28)29)35-23-22-21(33-24(30)34-23)18(10-12-31-22)13-17-8-9-19(36-4)14-20(17)37-5/h8-10,12,14,16,32H,6-7,11,13,15H2,1-5H3,(H3,30,33,34,35)/t16-,25+/m0/s1 |
| InChIKey | GFWMAWNRPNISFJ-IVCQMTBJSA-N |
| XLogP | 5.12 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.60 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |