C22H15Cl5F3N3O4 — CID 122615475
2-chloro-5-[[(1S,3S)-2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[(4R)-3-oxo-2-(2,2,2-trifluoroethyl)-1,2-oxazolidin-4-yl]benzamide (PubChem CID 122615475) has the molecular formula C22H15Cl5F3N3O4 and a molecular weight of 619.64 g/mol. Its IUPAC name is 2-chloro-5-[[(1S,3S)-2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[(4R)-3-oxo-2-(2,2,2-trifluoroethyl)-1,2-oxazolidin-4-yl]benzamide.
| Compound Name | 2-chloro-5-[[(1S,3S)-2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[(4R)-3-oxo-2-(2,2,2-trifluoroethyl)-1,2-oxazolidin-4-yl]benzamide |
|---|---|
| PubChem CID | 122615475 |
| Molecular Formula | C22H15Cl5F3N3O4 |
| Molecular Weight | 619.64 g/mol |
| Exact Mass | 616.95 |
| IUPAC Name | 2-chloro-5-[[(1S,3S)-2,2-dichloro-3-(3,4-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[(4R)-3-oxo-2-(2,2,2-trifluoroethyl)-1,2-oxazolidin-4-yl]benzamide |
| SMILES | O=C(N[C@@H]1CON(CC(F)(F)F)C1=O)c1cc(NC(=O)[C@@H]2[C@@H](c3ccc(Cl)c(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C22H15Cl5F3N3O4/c23-12-4-2-10(6-11(12)18(34)32-15-7-37-33(20(15)36)8-21(28,29)30)31-19(35)17-16(22(17,26)27)9-1-3-13(24)14(25)5-9/h1-6,15-17H,7-8H2,(H,31,35)(H,32,34)/t15-,16-,17+/m1/s1 |
| InChIKey | SQMKHYHFRCQCDB-ZACQAIPSSA-N |
| XLogP | 5.61 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.64 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|