C24H31N4O4S+ — CID 122636393
(E)-N-[4-(1,1-dimethyl-2-sulfanylideneimidazo[4,5-b]pyridin-1-ium-3-yl)butyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 122636393) has the molecular formula C24H31N4O4S+ and a molecular weight of 471.60 g/mol. Its IUPAC name is (E)-N-[4-(1,1-dimethyl-2-sulfanylideneimidazo[4,5-b]pyridin-1-ium-3-yl)butyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-(1,1-dimethyl-2-sulfanylideneimidazo[4,5-b]pyridin-1-ium-3-yl)butyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 122636393 |
| Molecular Formula | C24H31N4O4S+ |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | (E)-N-[4-(1,1-dimethyl-2-sulfanylideneimidazo[4,5-b]pyridin-1-ium-3-yl)butyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NCCCCN2C(=S)[N+](C)(C)c3cccnc32)cc(OC)c1OC |
| InChI | InChI=1S/C24H30N4O4S/c1-28(2)18-9-8-13-26-23(18)27(24(28)33)14-7-6-12-25-21(29)11-10-17-15-19(30-3)22(32-5)20(16-17)31-4/h8-11,13,15-16H,6-7,12,14H2,1-5H3/p+1/b11-10+ |
| InChIKey | XRVNMBXPQJRRDG-ZHACJKMWSA-O |
| XLogP | 3.39 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|