About 1-chloro-5-ethylundecane
1-chloro-5-ethylundecane (PubChem CID 122651411) has the molecular formula C13H27Cl
and a molecular weight of 218.81 g/mol. Its IUPAC name is 1-chloro-5-ethylundecane.
Molecular Properties
| Compound Name | 1-chloro-5-ethylundecane |
| PubChem CID | 122651411 |
| Molecular Formula | C13H27Cl |
| Molecular Weight | 218.81 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 1-chloro-5-ethylundecane |
| SMILES | CCCCCCC(CC)CCCCCl |
| InChI | InChI=1S/C13H27Cl/c1-3-5-6-7-10-13(4-2)11-8-9-12-14/h13H,3-12H2,1-2H3 |
| InChIKey | JNWDOIUMDOMGLH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 218.81 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-5-ethylundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-5-ethylundecane?
The IUPAC name of 1-chloro-5-ethylundecane (CID 122651411) is 1-chloro-5-ethylundecane.
What is the SMILES notation for 1-chloro-5-ethylundecane?
The canonical SMILES for 1-chloro-5-ethylundecane is CCCCCCC(CC)CCCCCl.
What is the InChIKey of 1-chloro-5-ethylundecane?
The InChIKey is JNWDOIUMDOMGLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27Cl/c1-3-5-6-7-10-13(4-2)11-8-9-12-14/h13H,3-12H2,1-2H3.
What are the key properties of 1-chloro-5-ethylundecane?
1-chloro-5-ethylundecane has a molecular weight of 218.81 g/mol, XLogP of 5.39, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-5-ethylundecane is sourced from PubChem (CID 122651411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).