C25H26F5N3O5S — CID 122662267
(2R)-1-[2-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3-tetrafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]acetyl]pyrrolidine-2-carboxamide (PubChem CID 122662267) has the molecular formula C25H26F5N3O5S and a molecular weight of 575.56 g/mol. Its IUPAC name is (2R)-1-[2-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3-tetrafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]acetyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-[2-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3-tetrafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]acetyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 122662267 |
| Molecular Formula | C25H26F5N3O5S |
| Molecular Weight | 575.56 g/mol |
| Exact Mass | 575.15 |
| IUPAC Name | (2R)-1-[2-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3-tetrafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]acetyl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)[C@H]1CCCN1C(=O)C[C@@H]1CCc2cc(C(O)(CF)C(F)(F)F)ccc2N1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H26F5N3O5S/c26-14-24(36,25(28,29)30)16-4-10-20-15(12-16)3-7-18(13-22(34)32-11-1-2-21(32)23(31)35)33(20)39(37,38)19-8-5-17(27)6-9-19/h4-6,8-10,12,18,21,36H,1-3,7,11,13-14H2,(H2,31,35)/t18-,21+,24?/m0/s1 |
| InChIKey | UKDDHAKCSHGUTR-XIYCMYMWSA-N |
| XLogP | 2.92 |
| TPSA | 121.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.56 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |