C27H29F5N4O6S — CID 122662336
N-[(1-ethyl-4-methyl-2,5-dioxoimidazolidin-4-yl)methyl]-2-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3-tetrafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]acetamide (PubChem CID 122662336) has the molecular formula C27H29F5N4O6S and a molecular weight of 632.61 g/mol. Its IUPAC name is N-[(1-ethyl-4-methyl-2,5-dioxoimidazolidin-4-yl)methyl]-2-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3-tetrafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]acetamide.
| Compound Name | N-[(1-ethyl-4-methyl-2,5-dioxoimidazolidin-4-yl)methyl]-2-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3-tetrafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]acetamide |
|---|---|
| PubChem CID | 122662336 |
| Molecular Formula | C27H29F5N4O6S |
| Molecular Weight | 632.61 g/mol |
| Exact Mass | 632.17 |
| IUPAC Name | N-[(1-ethyl-4-methyl-2,5-dioxoimidazolidin-4-yl)methyl]-2-[(2S)-1-(4-fluorophenyl)sulfonyl-6-(1,1,1,3-tetrafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]acetamide |
| SMILES | CCN1C(=O)NC(C)(CNC(=O)C[C@@H]2CCc3cc(C(O)(CF)C(F)(F)F)ccc3N2S(=O)(=O)c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C27H29F5N4O6S/c1-3-35-23(38)25(2,34-24(35)39)15-33-22(37)13-19-8-4-16-12-17(26(40,14-28)27(30,31)32)5-11-21(16)36(19)43(41,42)20-9-6-18(29)7-10-20/h5-7,9-12,19,40H,3-4,8,13-15H2,1-2H3,(H,33,37)(H,34,39)/t19-,25?,26?/m0/s1 |
| InChIKey | BHRYFEVLZFXAOC-RAYWSRASSA-N |
| XLogP | 2.89 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.61 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|