C25H42N7O6PS2 — CID 123138224
S-[2-[[5-(2,4-diaminoimidazo[2,1-f][1,2,4]triazin-7-yl)-4-methyloxolan-2-yl]methoxy-[2-(2,2-dimethylpropanimidoylsulfanyl)ethoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate (PubChem CID 123138224) has the molecular formula C25H42N7O6PS2 and a molecular weight of 631.76 g/mol. Its IUPAC name is S-[2-[[5-(2,4-diaminoimidazo[2,1-f][1,2,4]triazin-7-yl)-4-methyloxolan-2-yl]methoxy-[2-(2,2-dimethylpropanimidoylsulfanyl)ethoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[5-(2,4-diaminoimidazo[2,1-f][1,2,4]triazin-7-yl)-4-methyloxolan-2-yl]methoxy-[2-(2,2-dimethylpropanimidoylsulfanyl)ethoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 123138224 |
| Molecular Formula | C25H42N7O6PS2 |
| Molecular Weight | 631.76 g/mol |
| Exact Mass | 631.24 |
| IUPAC Name | S-[2-[[5-(2,4-diaminoimidazo[2,1-f][1,2,4]triazin-7-yl)-4-methyloxolan-2-yl]methoxy-[2-(2,2-dimethylpropanimidoylsulfanyl)ethoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
| SMILES | [H]/N=C(/SCCOP(=O)(OCCSC(=O)C(C)(C)C)OCC1CC(C)C(c2cnc3c(N)nc(N)nn23)O1)C(C)(C)C |
| InChI | InChI=1S/C25H42N7O6PS2/c1-15-12-16(38-18(15)17-13-29-20-19(26)30-23(28)31-32(17)20)14-37-39(34,35-8-10-40-21(27)24(2,3)4)36-9-11-41-22(33)25(5,6)7/h13,15-16,18,27H,8-12,14H2,1-7H3,(H4,26,28,30,31)/b27-21+ |
| InChIKey | AVUBQIYPMMRKNG-SZXQPVLSSA-N |
| XLogP | 4.98 |
| TPSA | 190.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.76 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|