C25H43N6O6PS2 — CID 126746734
S-[2-[[4-(2,4-diaminoimidazo[2,1-f][1,2,4]triazin-7-yl)-2-methoxypentoxy]-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphanyl]oxyethyl] 2,2-dimethylpropanethioate (PubChem CID 126746734) has the molecular formula C25H43N6O6PS2 and a molecular weight of 618.76 g/mol. Its IUPAC name is S-[2-[[4-(2,4-diaminoimidazo[2,1-f][1,2,4]triazin-7-yl)-2-methoxypentoxy]-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphanyl]oxyethyl] 2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[4-(2,4-diaminoimidazo[2,1-f][1,2,4]triazin-7-yl)-2-methoxypentoxy]-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphanyl]oxyethyl] 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 126746734 |
| Molecular Formula | C25H43N6O6PS2 |
| Molecular Weight | 618.76 g/mol |
| Exact Mass | 618.24 |
| IUPAC Name | S-[2-[[4-(2,4-diaminoimidazo[2,1-f][1,2,4]triazin-7-yl)-2-methoxypentoxy]-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphanyl]oxyethyl] 2,2-dimethylpropanethioate |
| SMILES | COC(COP(OCCSC(=O)C(C)(C)C)OCCSC(=O)C(C)(C)C)CC(C)c1cnc2c(N)nc(N)nn12 |
| InChI | InChI=1S/C25H43N6O6PS2/c1-16(18-14-28-20-19(26)29-23(27)30-31(18)20)13-17(34-8)15-37-38(35-9-11-39-21(32)24(2,3)4)36-10-12-40-22(33)25(5,6)7/h14,16-17H,9-13,15H2,1-8H3,(H4,26,27,29,30) |
| InChIKey | GWLSSAHQGQNFAL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 166.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.76 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|