C14H18O — CID 123157654
4-butoxy-1,2-dihydronaphthalene (PubChem CID 123157654) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is 4-butoxy-1,2-dihydronaphthalene.
| Compound Name | 4-butoxy-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 123157654 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 4-butoxy-1,2-dihydronaphthalene |
| SMILES | CCCCOC1=CCCc2ccccc21 |
| InChI | InChI=1S/C14H18O/c1-2-3-11-15-14-10-6-8-12-7-4-5-9-13(12)14/h4-5,7,9-10H,2-3,6,8,11H2,1H3 |
| InChIKey | YDYVRGSPUWCKRA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|