C19H22OS — CID 158710267
2-[(1S)-1-(3,4-dihydronaphthalen-1-yloxy)pentyl]thiophene (PubChem CID 158710267) has the molecular formula C19H22OS and a molecular weight of 298.45 g/mol. Its IUPAC name is 2-[(1S)-1-(3,4-dihydronaphthalen-1-yloxy)pentyl]thiophene.
| Compound Name | 2-[(1S)-1-(3,4-dihydronaphthalen-1-yloxy)pentyl]thiophene |
|---|---|
| PubChem CID | 158710267 |
| Molecular Formula | C19H22OS |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 2-[(1S)-1-(3,4-dihydronaphthalen-1-yloxy)pentyl]thiophene |
| SMILES | CCCC[C@H](OC1=CCCc2ccccc21)c1cccs1 |
| InChI | InChI=1S/C19H22OS/c1-2-3-11-18(19-13-7-14-21-19)20-17-12-6-9-15-8-4-5-10-16(15)17/h4-5,7-8,10,12-14,18H,2-3,6,9,11H2,1H3/t18-/m0/s1 |
| InChIKey | IIPXSGVHNMRMET-SFHVURJKSA-N |
| XLogP | 5.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |