C13H19NO8S — CID 123161989
2,5-dihydroxy-1-(8-oxononanoyloxy)pyrrole-3-sulfonic acid (PubChem CID 123161989) has the molecular formula C13H19NO8S and a molecular weight of 349.36 g/mol. Its IUPAC name is 2,5-dihydroxy-1-(8-oxononanoyloxy)pyrrole-3-sulfonic acid.
| Compound Name | 2,5-dihydroxy-1-(8-oxononanoyloxy)pyrrole-3-sulfonic acid |
|---|---|
| PubChem CID | 123161989 |
| Molecular Formula | C13H19NO8S |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 2,5-dihydroxy-1-(8-oxononanoyloxy)pyrrole-3-sulfonic acid |
| SMILES | CC(=O)CCCCCCC(=O)On1c(O)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C13H19NO8S/c1-9(15)6-4-2-3-5-7-12(17)22-14-11(16)8-10(13(14)18)23(19,20)21/h8,16,18H,2-7H2,1H3,(H,19,20,21) |
| InChIKey | ZARNJZXWGHJHRR-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 143.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|