C16H15NO7 — CID 123162157
(2,5-dihydroxypyrrol-1-yl) 2-(7-hydroxy-4-methyl-2-oxo-3,4-dihydrochromen-3-yl)acetate (PubChem CID 123162157) has the molecular formula C16H15NO7 and a molecular weight of 333.30 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-(7-hydroxy-4-methyl-2-oxo-3,4-dihydrochromen-3-yl)acetate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-(7-hydroxy-4-methyl-2-oxo-3,4-dihydrochromen-3-yl)acetate |
|---|---|
| PubChem CID | 123162157 |
| Molecular Formula | C16H15NO7 |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-(7-hydroxy-4-methyl-2-oxo-3,4-dihydrochromen-3-yl)acetate |
| SMILES | CC1c2ccc(O)cc2OC(=O)C1CC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C16H15NO7/c1-8-10-3-2-9(18)6-12(10)23-16(22)11(8)7-15(21)24-17-13(19)4-5-14(17)20/h2-6,8,11,18-20H,7H2,1H3 |
| InChIKey | PPCOGJSXYOFPHW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|