C16H16F3N3O — CID 123177932
2,2-dimethyl-5-methylidene-7-[(3,4,5-trifluorophenyl)methoxy]-3,8-dihydroimidazo[1,2-c]pyrimidine (PubChem CID 123177932) has the molecular formula C16H16F3N3O and a molecular weight of 323.32 g/mol. Its IUPAC name is 2,2-dimethyl-5-methylidene-7-[(3,4,5-trifluorophenyl)methoxy]-3,8-dihydroimidazo[1,2-c]pyrimidine.
| Compound Name | 2,2-dimethyl-5-methylidene-7-[(3,4,5-trifluorophenyl)methoxy]-3,8-dihydroimidazo[1,2-c]pyrimidine |
|---|---|
| PubChem CID | 123177932 |
| Molecular Formula | C16H16F3N3O |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 2,2-dimethyl-5-methylidene-7-[(3,4,5-trifluorophenyl)methoxy]-3,8-dihydroimidazo[1,2-c]pyrimidine |
| SMILES | C=C1N=C(OCc2cc(F)c(F)c(F)c2)CC2=NC(C)(C)CN12 |
| InChI | InChI=1S/C16H16F3N3O/c1-9-20-14(6-13-21-16(2,3)8-22(9)13)23-7-10-4-11(17)15(19)12(18)5-10/h4-5H,1,6-8H2,2-3H3 |
| InChIKey | XDMVPZFNLCLIEI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|