C6H11N — CID 123182045
2,2,3-trimethyl-1-azabicyclo[1.1.0]butane (PubChem CID 123182045) has the molecular formula C6H11N and a molecular weight of 97.16 g/mol. Its IUPAC name is 2,2,3-trimethyl-1-azabicyclo[1.1.0]butane.
| Compound Name | 2,2,3-trimethyl-1-azabicyclo[1.1.0]butane |
|---|---|
| PubChem CID | 123182045 |
| Molecular Formula | C6H11N |
| Molecular Weight | 97.16 g/mol |
| Exact Mass | 97.09 |
| IUPAC Name | 2,2,3-trimethyl-1-azabicyclo[1.1.0]butane |
| SMILES | CC1(C)N2CC21C |
| InChI | InChI=1S/C6H11N/c1-5(2)6(3)4-7(5)6/h4H2,1-3H3 |
| InChIKey | JIJPQVSAVWSYBP-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 97.16 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|