C27H58N2 — CID 159896810
methane;bis(1,2,2,3,3,4,4,5,5-nonamethylpyrrolidine) (PubChem CID 159896810) has the molecular formula C27H58N2 and a molecular weight of 410.78 g/mol. Its IUPAC name is methane;bis(1,2,2,3,3,4,4,5,5-nonamethylpyrrolidine).
| Compound Name | methane;bis(1,2,2,3,3,4,4,5,5-nonamethylpyrrolidine) |
|---|---|
| PubChem CID | 159896810 |
| Molecular Formula | C27H58N2 |
| Molecular Weight | 410.78 g/mol |
| Exact Mass | 410.46 |
| IUPAC Name | methane;bis(1,2,2,3,3,4,4,5,5-nonamethylpyrrolidine) |
| SMILES | C.CN1C(C)(C)C(C)(C)C(C)(C)C1(C)C.CN1C(C)(C)C(C)(C)C(C)(C)C1(C)C |
| InChI | InChI=1S/2C13H27N.CH4/c2*1-10(2)11(3,4)13(7,8)14(9)12(10,5)6;/h2*1-9H3;1H4 |
| InChIKey | NVLHEIKJHQRULM-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.78 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |