C12H24NY- — CID 59247972
1,2,2,3,3,4,5,5-octamethylpyrrolidin-4-ide;yttrium (PubChem CID 59247972) has the molecular formula C12H24NY- and a molecular weight of 271.24 g/mol. Its IUPAC name is 1,2,2,3,3,4,5,5-octamethylpyrrolidin-4-ide;yttrium.
| Compound Name | 1,2,2,3,3,4,5,5-octamethylpyrrolidin-4-ide;yttrium |
|---|---|
| PubChem CID | 59247972 |
| Molecular Formula | C12H24NY- |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 1,2,2,3,3,4,5,5-octamethylpyrrolidin-4-ide;yttrium |
| SMILES | C[C-]1C(C)(C)N(C)C(C)(C)C1(C)C.[Y] |
| InChI | InChI=1S/C12H24N.Y/c1-9-10(2,3)12(6,7)13(8)11(9,4)5;/h1-8H3;/q-1; |
| InChIKey | ASYNBQTXXLFATD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|