C12H21N — CID 123238114
4-(5-methylhexa-2,4-dien-2-yl)piperidine (PubChem CID 123238114) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is 4-(5-methylhexa-2,4-dien-2-yl)piperidine.
| Compound Name | 4-(5-methylhexa-2,4-dien-2-yl)piperidine |
|---|---|
| PubChem CID | 123238114 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 4-(5-methylhexa-2,4-dien-2-yl)piperidine |
| SMILES | CC(C)=CC=C(C)C1CCNCC1 |
| InChI | InChI=1S/C12H21N/c1-10(2)4-5-11(3)12-6-8-13-9-7-12/h4-5,12-13H,6-9H2,1-3H3 |
| InChIKey | CFHRTZDSUJIMJP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|