C17H28ClFN4S — CID 123278732
5-[2-(3-chloro-4-fluorocyclohex-3-en-1-yl)piperidin-3-yl]-1,2,3a,4,5,6,7,7a-octahydro-[1,3]thiazolo[5,4-b]pyridin-2-amine (PubChem CID 123278732) has the molecular formula C17H28ClFN4S and a molecular weight of 374.96 g/mol. Its IUPAC name is 5-[2-(3-chloro-4-fluorocyclohex-3-en-1-yl)piperidin-3-yl]-1,2,3a,4,5,6,7,7a-octahydro-[1,3]thiazolo[5,4-b]pyridin-2-amine.
| Compound Name | 5-[2-(3-chloro-4-fluorocyclohex-3-en-1-yl)piperidin-3-yl]-1,2,3a,4,5,6,7,7a-octahydro-[1,3]thiazolo[5,4-b]pyridin-2-amine |
|---|---|
| PubChem CID | 123278732 |
| Molecular Formula | C17H28ClFN4S |
| Molecular Weight | 374.96 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 5-[2-(3-chloro-4-fluorocyclohex-3-en-1-yl)piperidin-3-yl]-1,2,3a,4,5,6,7,7a-octahydro-[1,3]thiazolo[5,4-b]pyridin-2-amine |
| SMILES | NC1NC2CCC(C3CCCNC3C3CCC(F)=C(Cl)C3)NC2S1 |
| InChI | InChI=1S/C17H28ClFN4S/c18-11-8-9(3-4-12(11)19)15-10(2-1-7-21-15)13-5-6-14-16(22-13)24-17(20)23-14/h9-10,13-17,21-23H,1-8,20H2 |
| InChIKey | YLDZQXLJSDQTOK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.96 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |