C25H42N2 — CID 123306532
1,3-bis(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)-2H-imidazole (PubChem CID 123306532) has the molecular formula C25H42N2 and a molecular weight of 370.62 g/mol. Its IUPAC name is 1,3-bis(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)-2H-imidazole.
| Compound Name | 1,3-bis(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)-2H-imidazole |
|---|---|
| PubChem CID | 123306532 |
| Molecular Formula | C25H42N2 |
| Molecular Weight | 370.62 g/mol |
| Exact Mass | 370.33 |
| IUPAC Name | 1,3-bis(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)-2H-imidazole |
| SMILES | CC1CC2CC(C1)CC(C)(N1C=CN(C3(C)CC4CC(C)CC(C4)C3)C1)C2 |
| InChI | InChI=1S/C25H42N2/c1-18-7-20-11-21(8-18)14-24(3,13-20)26-5-6-27(17-26)25(4)15-22-9-19(2)10-23(12-22)16-25/h5-6,18-23H,7-17H2,1-4H3 |
| InChIKey | OZLZDAZYDQYQKQ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.62 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |