C30H34N6O2 — CID 123307154
(Z)-N-(1-adamantyl)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-isocyanoprop-2-enamide (PubChem CID 123307154) has the molecular formula C30H34N6O2 and a molecular weight of 510.64 g/mol. Its IUPAC name is (Z)-N-(1-adamantyl)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-isocyanoprop-2-enamide.
| Compound Name | (Z)-N-(1-adamantyl)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-isocyanoprop-2-enamide |
|---|---|
| PubChem CID | 123307154 |
| Molecular Formula | C30H34N6O2 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | (Z)-N-(1-adamantyl)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-isocyanoprop-2-enamide |
| SMILES | [C-]#[N+]/C(=C\c1c(-c2ccc(C)cc2)c2c(N)ncnc2n1CCCO)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C30H34N6O2/c1-18-4-6-22(7-5-18)25-24(36(8-3-9-37)28-26(25)27(31)33-17-34-28)13-23(32-2)29(38)35-30-14-19-10-20(15-30)12-21(11-19)16-30/h4-7,13,17,19-21,37H,3,8-12,14-16H2,1H3,(H,35,38)(H2,31,33,34)/b23-13- |
| InChIKey | BNGICVGVJXUOOJ-QRVIBDJDSA-N |
| XLogP | 4.72 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|