C27H31F5O5Si2 — CID 123314514
diethoxy-[2-[methoxy-bis(4-methylphenyl)silyl]oxyethoxy]-(2,3,4,5,6-pentafluorophenyl)silane (PubChem CID 123314514) has the molecular formula C27H31F5O5Si2 and a molecular weight of 586.70 g/mol. Its IUPAC name is diethoxy-[2-[methoxy-bis(4-methylphenyl)silyl]oxyethoxy]-(2,3,4,5,6-pentafluorophenyl)silane.
| Compound Name | diethoxy-[2-[methoxy-bis(4-methylphenyl)silyl]oxyethoxy]-(2,3,4,5,6-pentafluorophenyl)silane |
|---|---|
| PubChem CID | 123314514 |
| Molecular Formula | C27H31F5O5Si2 |
| Molecular Weight | 586.70 g/mol |
| Exact Mass | 586.16 |
| IUPAC Name | diethoxy-[2-[methoxy-bis(4-methylphenyl)silyl]oxyethoxy]-(2,3,4,5,6-pentafluorophenyl)silane |
| SMILES | CCO[Si](OCC)(OCCO[Si](OC)(c1ccc(C)cc1)c1ccc(C)cc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C27H31F5O5Si2/c1-6-34-39(35-7-2,27-25(31)23(29)22(28)24(30)26(27)32)37-17-16-36-38(33-5,20-12-8-18(3)9-13-20)21-14-10-19(4)11-15-21/h8-15H,6-7,16-17H2,1-5H3 |
| InChIKey | TVXUTXXXFGLXBA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.70 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|