C18H23F6NS — CID 123347641
1-[3,5-bis(trifluoromethyl)phenyl]-N-[tert-butyl(ethylidene)-λ4-sulfanyl]-N-methylprop-2-en-1-amine (PubChem CID 123347641) has the molecular formula C18H23F6NS and a molecular weight of 399.44 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-N-[tert-butyl(ethylidene)-λ4-sulfanyl]-N-methylprop-2-en-1-amine.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-N-[tert-butyl(ethylidene)-λ4-sulfanyl]-N-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 123347641 |
| Molecular Formula | C18H23F6NS |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-N-[tert-butyl(ethylidene)-λ4-sulfanyl]-N-methylprop-2-en-1-amine |
| SMILES | C=CC(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)N(C)S(=CC)C(C)(C)C |
| InChI | InChI=1S/C18H23F6NS/c1-7-15(25(6)26(8-2)16(3,4)5)12-9-13(17(19,20)21)11-14(10-12)18(22,23)24/h7-11,15H,1H2,2-6H3 |
| InChIKey | BNTORTCXBHIQBC-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|