C12H17N — CID 123351664
N-(8-methyl-6-methylidenenona-2,4,8-trien-3-yl)methanimine (PubChem CID 123351664) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is N-(8-methyl-6-methylidenenona-2,4,8-trien-3-yl)methanimine.
| Compound Name | N-(8-methyl-6-methylidenenona-2,4,8-trien-3-yl)methanimine |
|---|---|
| PubChem CID | 123351664 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | N-(8-methyl-6-methylidenenona-2,4,8-trien-3-yl)methanimine |
| SMILES | C=NC(C=CC(=C)CC(=C)C)=CC |
| InChI | InChI=1S/C12H17N/c1-6-12(13-5)8-7-11(4)9-10(2)3/h6-8H,2,4-5,9H2,1,3H3 |
| InChIKey | FRKJVRHKOFMGMG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|