About (2-oxoquinolin-1-yl) 4-ethenylbenzenesulfonate
(2-oxoquinolin-1-yl) 4-ethenylbenzenesulfonate (PubChem CID 123352382) has the molecular formula C17H13NO4S
and a molecular weight of 327.36 g/mol. Its IUPAC name is (2-oxoquinolin-1-yl) 4-ethenylbenzenesulfonate.
Molecular Properties
| Compound Name | (2-oxoquinolin-1-yl) 4-ethenylbenzenesulfonate |
| PubChem CID | 123352382 |
| Molecular Formula | C17H13NO4S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | (2-oxoquinolin-1-yl) 4-ethenylbenzenesulfonate |
| SMILES | C=Cc1ccc(S(=O)(=O)On2c(=O)ccc3ccccc32)cc1 |
| InChI | InChI=1S/C17H13NO4S/c1-2-13-7-10-15(11-8-13)23(20,21)22-18-16-6-4-3-5-14(16)9-12-17(18)19/h2-12H,1H2 |
| InChIKey | ZGSJCPXEEUDKNX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-oxoquinolin-1-yl) 4-ethenylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxoquinolin-1-yl) 4-ethenylbenzenesulfonate?
The IUPAC name of (2-oxoquinolin-1-yl) 4-ethenylbenzenesulfonate (CID 123352382) is (2-oxoquinolin-1-yl) 4-ethenylbenzenesulfonate.
What is the SMILES notation for (2-oxoquinolin-1-yl) 4-ethenylbenzenesulfonate?
The canonical SMILES for (2-oxoquinolin-1-yl) 4-ethenylbenzenesulfonate is C=Cc1ccc(S(=O)(=O)On2c(=O)ccc3ccccc32)cc1.
What is the InChIKey of (2-oxoquinolin-1-yl) 4-ethenylbenzenesulfonate?
The InChIKey is ZGSJCPXEEUDKNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NO4S/c1-2-13-7-10-15(11-8-13)23(20,21)22-18-16-6-4-3-5-14(16)9-12-17(18)19/h2-12H,1H2.
What are the key properties of (2-oxoquinolin-1-yl) 4-ethenylbenzenesulfonate?
(2-oxoquinolin-1-yl) 4-ethenylbenzenesulfonate has a molecular weight of 327.36 g/mol, XLogP of 2.46, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxoquinolin-1-yl) 4-ethenylbenzenesulfonate is sourced from PubChem (CID 123352382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).