C7H12O9P2 — CID 123379596
(2,7-dioxo-7-phosphonoheptanoyl)phosphonic acid (PubChem CID 123379596) has the molecular formula C7H12O9P2 and a molecular weight of 302.11 g/mol. Its IUPAC name is (2,7-dioxo-7-phosphonoheptanoyl)phosphonic acid.
| Compound Name | (2,7-dioxo-7-phosphonoheptanoyl)phosphonic acid |
|---|---|
| PubChem CID | 123379596 |
| Molecular Formula | C7H12O9P2 |
| Molecular Weight | 302.11 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | (2,7-dioxo-7-phosphonoheptanoyl)phosphonic acid |
| SMILES | O=C(CCCCC(=O)P(=O)(O)O)C(=O)P(=O)(O)O |
| InChI | InChI=1S/C7H12O9P2/c8-5(7(10)18(14,15)16)3-1-2-4-6(9)17(11,12)13/h1-4H2,(H2,11,12,13)(H2,14,15,16) |
| InChIKey | XHGRQCYZCGCYLT-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 166.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.11 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|