About lithium;methanol;4-oxo-4-phosphonobutanoate
lithium;methanol;4-oxo-4-phosphonobutanoate (PubChem CID 175025101) has the molecular formula C5H10LiO7P
and a molecular weight of 220.04 g/mol. Its IUPAC name is lithium;methanol;4-oxo-4-phosphonobutanoate.
Molecular Properties
| Compound Name | lithium;methanol;4-oxo-4-phosphonobutanoate |
| PubChem CID | 175025101 |
| Molecular Formula | C5H10LiO7P |
| Molecular Weight | 220.04 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | lithium;methanol;4-oxo-4-phosphonobutanoate |
| SMILES | CO.O=C([O-])CCC(=O)P(=O)(O)O.[Li+] |
| InChI | InChI=1S/C4H7O6P.CH4O.Li/c5-3(6)1-2-4(7)11(8,9)10;1-2;/h1-2H2,(H,5,6)(H2,8,9,10);2H,1H3;/q;;+1/p-1 |
| InChIKey | MRQXZFGFOLPXGL-UHFFFAOYSA-M |
| XLogP | -5.17 |
| TPSA | 134.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.04 |
| LogP ≤ 5 | -5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze lithium;methanol;4-oxo-4-phosphonobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;methanol;4-oxo-4-phosphonobutanoate?
The IUPAC name of lithium;methanol;4-oxo-4-phosphonobutanoate (CID 175025101) is lithium;methanol;4-oxo-4-phosphonobutanoate.
What is the SMILES notation for lithium;methanol;4-oxo-4-phosphonobutanoate?
The canonical SMILES for lithium;methanol;4-oxo-4-phosphonobutanoate is CO.O=C([O-])CCC(=O)P(=O)(O)O.[Li+].
What is the InChIKey of lithium;methanol;4-oxo-4-phosphonobutanoate?
The InChIKey is MRQXZFGFOLPXGL-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H7O6P.CH4O.Li/c5-3(6)1-2-4(7)11(8,9)10;1-2;/h1-2H2,(H,5,6)(H2,8,9,10);2H,1H3;/q;;+1/p-1.
What are the key properties of lithium;methanol;4-oxo-4-phosphonobutanoate?
lithium;methanol;4-oxo-4-phosphonobutanoate has a molecular weight of 220.04 g/mol, XLogP of -5.17, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;methanol;4-oxo-4-phosphonobutanoate is sourced from PubChem (CID 175025101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).