C24H33ClN5O7P — CID 123386364
propan-2-yl 2-[[[2-[(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)methoxy]-4-chloro-3-hydroxypentoxy]-phenoxyphosphoryl]amino]propanoate (PubChem CID 123386364) has the molecular formula C24H33ClN5O7P and a molecular weight of 569.98 g/mol. Its IUPAC name is propan-2-yl 2-[[[2-[(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)methoxy]-4-chloro-3-hydroxypentoxy]-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[2-[(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)methoxy]-4-chloro-3-hydroxypentoxy]-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 123386364 |
| Molecular Formula | C24H33ClN5O7P |
| Molecular Weight | 569.98 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | propan-2-yl 2-[[[2-[(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)methoxy]-4-chloro-3-hydroxypentoxy]-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)C(C)NP(=O)(OCC(OCn1ccc2c(N)ncnc21)C(O)C(C)Cl)Oc1ccccc1 |
| InChI | InChI=1S/C24H33ClN5O7P/c1-15(2)36-24(32)17(4)29-38(33,37-18-8-6-5-7-9-18)35-12-20(21(31)16(3)25)34-14-30-11-10-19-22(26)27-13-28-23(19)30/h5-11,13,15-17,20-21,31H,12,14H2,1-4H3,(H,29,33)(H2,26,27,28) |
| InChIKey | QZDADTHHFBGMMC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 160.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.98 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|