C14H17N3OS — CID 123398069
1-(2-methoxyphenyl)-3-(4-methyliminopent-1-en-3-ylidene)thiourea (PubChem CID 123398069) has the molecular formula C14H17N3OS and a molecular weight of 275.38 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-(4-methyliminopent-1-en-3-ylidene)thiourea.
| Compound Name | 1-(2-methoxyphenyl)-3-(4-methyliminopent-1-en-3-ylidene)thiourea |
|---|---|
| PubChem CID | 123398069 |
| Molecular Formula | C14H17N3OS |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-(4-methyliminopent-1-en-3-ylidene)thiourea |
| SMILES | C=CC(=NC(=S)Nc1ccccc1OC)/C(C)=N/C |
| InChI | InChI=1S/C14H17N3OS/c1-5-11(10(2)15-3)16-14(19)17-12-8-6-7-9-13(12)18-4/h5-9H,1H2,2-4H3,(H,17,19)/b15-10+,16-11? |
| InChIKey | ARWLMTXKPBGWGM-FEWYVSLTSA-N |
| XLogP | 3.11 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|