C30H37N3O6 — CID 123405233
10-hydroxy-4a-[4-(methylamino)pent-2-en-2-yl]-8-(1-methylpyrrolidin-2-yl)-1,3,11,12-tetraoxo-4,5,5a,6,11a,12a-hexahydrotetracene-2-carboxamide (PubChem CID 123405233) has the molecular formula C30H37N3O6 and a molecular weight of 535.64 g/mol. Its IUPAC name is 10-hydroxy-4a-[4-(methylamino)pent-2-en-2-yl]-8-(1-methylpyrrolidin-2-yl)-1,3,11,12-tetraoxo-4,5,5a,6,11a,12a-hexahydrotetracene-2-carboxamide.
| Compound Name | 10-hydroxy-4a-[4-(methylamino)pent-2-en-2-yl]-8-(1-methylpyrrolidin-2-yl)-1,3,11,12-tetraoxo-4,5,5a,6,11a,12a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123405233 |
| Molecular Formula | C30H37N3O6 |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.27 |
| IUPAC Name | 10-hydroxy-4a-[4-(methylamino)pent-2-en-2-yl]-8-(1-methylpyrrolidin-2-yl)-1,3,11,12-tetraoxo-4,5,5a,6,11a,12a-hexahydrotetracene-2-carboxamide |
| SMILES | CNC(C)C=C(C)C12CC(=O)C(C(N)=O)C(=O)C1C(=O)C1C(=O)c3c(O)cc(C4CCCN4C)cc3CC1C2 |
| InChI | InChI=1S/C30H37N3O6/c1-14(8-15(2)32-3)30-12-18-10-17-9-16(19-6-5-7-33(19)4)11-20(34)22(17)26(36)23(18)27(37)25(30)28(38)24(29(31)39)21(35)13-30/h8-9,11,15,18-19,23-25,32,34H,5-7,10,12-13H2,1-4H3,(H2,31,39) |
| InChIKey | CTLHOWBBIIGGQA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 146.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|