C17H22N2O3 — CID 123412703
(6R)-N-hydroxy-4,6-dimethyl-7-[4-(methylaminomethyl)phenyl]-7-oxohepta-2,4-dienamide (PubChem CID 123412703) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is (6R)-N-hydroxy-4,6-dimethyl-7-[4-(methylaminomethyl)phenyl]-7-oxohepta-2,4-dienamide.
| Compound Name | (6R)-N-hydroxy-4,6-dimethyl-7-[4-(methylaminomethyl)phenyl]-7-oxohepta-2,4-dienamide |
|---|---|
| PubChem CID | 123412703 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | (6R)-N-hydroxy-4,6-dimethyl-7-[4-(methylaminomethyl)phenyl]-7-oxohepta-2,4-dienamide |
| SMILES | CNCc1ccc(C(=O)[C@H](C)C=C(C)C=CC(=O)NO)cc1 |
| InChI | InChI=1S/C17H22N2O3/c1-12(4-9-16(20)19-22)10-13(2)17(21)15-7-5-14(6-8-15)11-18-3/h4-10,13,18,22H,11H2,1-3H3,(H,19,20)/t13-/m1/s1 |
| InChIKey | GFCPAMYIIRJQOP-CYBMUJFWSA-N |
| XLogP | 2.23 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|