C28H50N2O6 — CID 123419827
4-amino-1-(ethylideneamino)-2,9,9,11,11-pentamethyl-14-[2,3,5-trihydroxy-4-(hydroxymethyl)-6-oxabicyclo[3.2.0]heptan-7-yl]tetradec-1-en-5-one (PubChem CID 123419827) has the molecular formula C28H50N2O6 and a molecular weight of 510.72 g/mol. Its IUPAC name is 4-amino-1-(ethylideneamino)-2,9,9,11,11-pentamethyl-14-[2,3,5-trihydroxy-4-(hydroxymethyl)-6-oxabicyclo[3.2.0]heptan-7-yl]tetradec-1-en-5-one.
| Compound Name | 4-amino-1-(ethylideneamino)-2,9,9,11,11-pentamethyl-14-[2,3,5-trihydroxy-4-(hydroxymethyl)-6-oxabicyclo[3.2.0]heptan-7-yl]tetradec-1-en-5-one |
|---|---|
| PubChem CID | 123419827 |
| Molecular Formula | C28H50N2O6 |
| Molecular Weight | 510.72 g/mol |
| Exact Mass | 510.37 |
| IUPAC Name | 4-amino-1-(ethylideneamino)-2,9,9,11,11-pentamethyl-14-[2,3,5-trihydroxy-4-(hydroxymethyl)-6-oxabicyclo[3.2.0]heptan-7-yl]tetradec-1-en-5-one |
| SMILES | C/C=N/C=C(C)CC(N)C(=O)CCCC(C)(C)CC(C)(C)CCCC1OC2(O)C(CO)C(O)C(O)C12 |
| InChI | InChI=1S/C28H50N2O6/c1-7-30-15-18(2)14-20(29)21(32)10-8-12-26(3,4)17-27(5,6)13-9-11-22-23-25(34)24(33)19(16-31)28(23,35)36-22/h7,15,19-20,22-25,31,33-35H,8-14,16-17,29H2,1-6H3/b18-15?,30-7+ |
| InChIKey | WVJXCCKMJCQDHF-AGGWQWGISA-N |
| XLogP | 3.10 |
| TPSA | 145.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.72 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|