C22H40N2O6 — CID 123927216
2-amino-4-imino-5,5,7,7-tetramethyl-11-[2,3,5-trihydroxy-4-(hydroxymethyl)-6-oxabicyclo[3.2.0]heptan-7-yl]undecan-3-one (PubChem CID 123927216) has the molecular formula C22H40N2O6 and a molecular weight of 428.57 g/mol. Its IUPAC name is 2-amino-4-imino-5,5,7,7-tetramethyl-11-[2,3,5-trihydroxy-4-(hydroxymethyl)-6-oxabicyclo[3.2.0]heptan-7-yl]undecan-3-one.
| Compound Name | 2-amino-4-imino-5,5,7,7-tetramethyl-11-[2,3,5-trihydroxy-4-(hydroxymethyl)-6-oxabicyclo[3.2.0]heptan-7-yl]undecan-3-one |
|---|---|
| PubChem CID | 123927216 |
| Molecular Formula | C22H40N2O6 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | 2-amino-4-imino-5,5,7,7-tetramethyl-11-[2,3,5-trihydroxy-4-(hydroxymethyl)-6-oxabicyclo[3.2.0]heptan-7-yl]undecan-3-one |
| SMILES | [H]/N=C(\C(=O)C(C)N)C(C)(C)CC(C)(C)CCCCC1OC2(O)C(CO)C(O)C(O)C12 |
| InChI | InChI=1S/C22H40N2O6/c1-12(23)16(26)19(24)21(4,5)11-20(2,3)9-7-6-8-14-15-18(28)17(27)13(10-25)22(15,29)30-14/h12-15,17-18,24-25,27-29H,6-11,23H2,1-5H3/b24-19+ |
| InChIKey | ADSNWSNDPLJKQJ-LYBHJNIJSA-N |
| XLogP | 0.97 |
| TPSA | 157.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|