C21H34 — CID 123435944
6-ethyl-2,9,12,12-tetramethyl-3-methylidenetetradeca-4,6,8,10-tetraene (PubChem CID 123435944) has the molecular formula C21H34 and a molecular weight of 286.50 g/mol. Its IUPAC name is 6-ethyl-2,9,12,12-tetramethyl-3-methylidenetetradeca-4,6,8,10-tetraene.
| Compound Name | 6-ethyl-2,9,12,12-tetramethyl-3-methylidenetetradeca-4,6,8,10-tetraene |
|---|---|
| PubChem CID | 123435944 |
| Molecular Formula | C21H34 |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.27 |
| IUPAC Name | 6-ethyl-2,9,12,12-tetramethyl-3-methylidenetetradeca-4,6,8,10-tetraene |
| SMILES | C=C(C=CC(=CC=C(C)C=CC(C)(C)CC)CC)C(C)C |
| InChI | InChI=1S/C21H34/c1-9-20(14-12-19(6)17(3)4)13-11-18(5)15-16-21(7,8)10-2/h11-17H,6,9-10H2,1-5,7-8H3 |
| InChIKey | XPNQIMIOCBMFBH-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|