C15H25N — CID 123447656
(3Z,5E,7Z)-6-butan-2-yl-5-methyldeca-3,5,7-trien-2-imine (PubChem CID 123447656) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is (3Z,5E,7Z)-6-butan-2-yl-5-methyldeca-3,5,7-trien-2-imine.
| Compound Name | (3Z,5E,7Z)-6-butan-2-yl-5-methyldeca-3,5,7-trien-2-imine |
|---|---|
| PubChem CID | 123447656 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | (3Z,5E,7Z)-6-butan-2-yl-5-methyldeca-3,5,7-trien-2-imine |
| SMILES | [H]/N=C(C)/C=C\C(C)=C(\C=C/CC)C(C)CC |
| InChI | InChI=1S/C15H25N/c1-6-8-9-15(12(3)7-2)13(4)10-11-14(5)16/h8-12,16H,6-7H2,1-5H3/b9-8-,11-10-,15-13-,16-14+ |
| InChIKey | MYEHQMUUAGADPE-HOKIRQNWSA-N |
| XLogP | 4.91 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|