C15H19F2N — CID 145383058
(2Z,4E,8Z,10Z)-3,5-difluoro-2,6,7,11-tetramethylcycloundeca-2,4,8,10-tetraen-1-imine (PubChem CID 145383058) has the molecular formula C15H19F2N and a molecular weight of 251.32 g/mol. Its IUPAC name is (2Z,4E,8Z,10Z)-3,5-difluoro-2,6,7,11-tetramethylcycloundeca-2,4,8,10-tetraen-1-imine.
| Compound Name | (2Z,4E,8Z,10Z)-3,5-difluoro-2,6,7,11-tetramethylcycloundeca-2,4,8,10-tetraen-1-imine |
|---|---|
| PubChem CID | 145383058 |
| Molecular Formula | C15H19F2N |
| Molecular Weight | 251.32 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | (2Z,4E,8Z,10Z)-3,5-difluoro-2,6,7,11-tetramethylcycloundeca-2,4,8,10-tetraen-1-imine |
| SMILES | [H]/N=C1C(\C)=C/C=C\C(C)C(C)/C(F)=C\C(F)=C\1C |
| InChI | InChI=1S/C15H19F2N/c1-9-6-5-7-10(2)15(18)12(4)14(17)8-13(16)11(9)3/h5-9,11,18H,1-4H3/b6-5-,10-7-,13-8+,14-12-,18-15+ |
| InChIKey | KMQRDQSLYNGRBD-QFUABMKXSA-N |
| XLogP | 4.89 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.32 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|