C22H38S — CID 123456800
(4,6-dimethyl-7-propan-2-ylsulfanyl-3-propylocta-2,4,6-trien-2-yl)cyclohexane (PubChem CID 123456800) has the molecular formula C22H38S and a molecular weight of 334.61 g/mol. Its IUPAC name is (4,6-dimethyl-7-propan-2-ylsulfanyl-3-propylocta-2,4,6-trien-2-yl)cyclohexane.
| Compound Name | (4,6-dimethyl-7-propan-2-ylsulfanyl-3-propylocta-2,4,6-trien-2-yl)cyclohexane |
|---|---|
| PubChem CID | 123456800 |
| Molecular Formula | C22H38S |
| Molecular Weight | 334.61 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | (4,6-dimethyl-7-propan-2-ylsulfanyl-3-propylocta-2,4,6-trien-2-yl)cyclohexane |
| SMILES | CCCC(C(C)=CC(C)=C(C)SC(C)C)=C(C)C1CCCCC1 |
| InChI | InChI=1S/C22H38S/c1-8-12-22(19(6)21-13-10-9-11-14-21)18(5)15-17(4)20(7)23-16(2)3/h15-16,21H,8-14H2,1-7H3 |
| InChIKey | BFWKILGQAABTCJ-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.61 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|