C24H27N3O2S — CID 123457897
5-ethyl-4-(5-ethyl-2,4-dihydroxyphenyl)-3-(3-ethyl-1-methylindol-5-yl)-1H-imidazole-2-thione (PubChem CID 123457897) has the molecular formula C24H27N3O2S and a molecular weight of 421.57 g/mol. Its IUPAC name is 5-ethyl-4-(5-ethyl-2,4-dihydroxyphenyl)-3-(3-ethyl-1-methylindol-5-yl)-1H-imidazole-2-thione.
| Compound Name | 5-ethyl-4-(5-ethyl-2,4-dihydroxyphenyl)-3-(3-ethyl-1-methylindol-5-yl)-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 123457897 |
| Molecular Formula | C24H27N3O2S |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 5-ethyl-4-(5-ethyl-2,4-dihydroxyphenyl)-3-(3-ethyl-1-methylindol-5-yl)-1H-imidazole-2-thione |
| SMILES | CCc1cc(-c2c(CC)[nH]c(=S)n2-c2ccc3c(c2)c(CC)cn3C)c(O)cc1O |
| InChI | InChI=1S/C24H27N3O2S/c1-5-14-10-18(22(29)12-21(14)28)23-19(7-3)25-24(30)27(23)16-8-9-20-17(11-16)15(6-2)13-26(20)4/h8-13,28-29H,5-7H2,1-4H3,(H,25,30) |
| InChIKey | ISQWWCGNMIQAAM-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 66.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|