C30H29N5O — CID 123461475
5-(5-methoxy-4,6-dimethylhepta-1,3,5-trien-2-yl)-5-[3-(5-prop-1-ynyl-3-pyridinyl)phenyl]pyrrolo[3,4-b]pyrazin-7-amine (PubChem CID 123461475) has the molecular formula C30H29N5O and a molecular weight of 475.60 g/mol. Its IUPAC name is 5-(5-methoxy-4,6-dimethylhepta-1,3,5-trien-2-yl)-5-[3-(5-prop-1-ynyl-3-pyridinyl)phenyl]pyrrolo[3,4-b]pyrazin-7-amine.
| Compound Name | 5-(5-methoxy-4,6-dimethylhepta-1,3,5-trien-2-yl)-5-[3-(5-prop-1-ynyl-3-pyridinyl)phenyl]pyrrolo[3,4-b]pyrazin-7-amine |
|---|---|
| PubChem CID | 123461475 |
| Molecular Formula | C30H29N5O |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | 5-(5-methoxy-4,6-dimethylhepta-1,3,5-trien-2-yl)-5-[3-(5-prop-1-ynyl-3-pyridinyl)phenyl]pyrrolo[3,4-b]pyrazin-7-amine |
| SMILES | C=C(C=C(C)C(OC)=C(C)C)C1(c2cccc(-c3cncc(C#CC)c3)c2)N=C(N)c2nccnc21 |
| InChI | InChI=1S/C30H29N5O/c1-7-9-22-15-24(18-32-17-22)23-10-8-11-25(16-23)30(21(5)14-20(4)27(36-6)19(2)3)28-26(29(31)35-30)33-12-13-34-28/h8,10-18H,5H2,1-4,6H3,(H2,31,35) |
| InChIKey | NZWZGOMNJQJXFA-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|